C22H22N2O — CID 910003
2-phenylspiro[1,5-dihydrobenzo[g]indazole-4,1'-cyclohexane]-3-one (PubChem CID 910003) has the molecular formula C22H22N2O and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-phenylspiro[1,5-dihydrobenzo[g]indazole-4,1'-cyclohexane]-3-one.
| Compound Name | 2-phenylspiro[1,5-dihydrobenzo[g]indazole-4,1'-cyclohexane]-3-one |
|---|---|
| PubChem CID | 910003 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-phenylspiro[1,5-dihydrobenzo[g]indazole-4,1'-cyclohexane]-3-one |
| SMILES | O=c1c2c([nH]n1-c1ccccc1)-c1ccccc1CC21CCCCC1 |
| InChI | InChI=1S/C22H22N2O/c25-21-19-20(23-24(21)17-10-3-1-4-11-17)18-12-6-5-9-16(18)15-22(19)13-7-2-8-14-22/h1,3-6,9-12,23H,2,7-8,13-15H2 |
| InChIKey | MBWNXBJZZIXDIE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |