C17H22NO5- — CID 53302207
(2S,3S)-2-tert-butyl-3-carboxy-4-(4-methoxyphenyl)pyrrolidine-1-carboxylate (PubChem CID 53302207) has the molecular formula C17H22NO5- and a molecular weight of 320.37 g/mol. Its IUPAC name is (2S,3S)-2-tert-butyl-3-carboxy-4-(4-methoxyphenyl)pyrrolidine-1-carboxylate.
| Compound Name | (2S,3S)-2-tert-butyl-3-carboxy-4-(4-methoxyphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53302207 |
| Molecular Formula | C17H22NO5- |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2S,3S)-2-tert-butyl-3-carboxy-4-(4-methoxyphenyl)pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(C2CN(C(=O)[O-])[C@H](C(C)(C)C)[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C17H23NO5/c1-17(2,3)14-13(15(19)20)12(9-18(14)16(21)22)10-5-7-11(23-4)8-6-10/h5-8,12-14H,9H2,1-4H3,(H,19,20)(H,21,22)/p-1/t12?,13-,14-/m0/s1 |
| InChIKey | CBQOBZPSUOXQAU-TTZKSVMKSA-M |
| XLogP | 1.55 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |