About hexoxy(trihexyl)silane
hexoxy(trihexyl)silane (PubChem CID 533027) has the molecular formula C24H52OSi
and a molecular weight of 384.77 g/mol. Its IUPAC name is hexoxy(trihexyl)silane.
Molecular Properties
| Compound Name | hexoxy(trihexyl)silane |
| PubChem CID | 533027 |
| Molecular Formula | C24H52OSi |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 384.38 |
| IUPAC Name | hexoxy(trihexyl)silane |
| SMILES | CCCCCCO[Si](CCCCCC)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C24H52OSi/c1-5-9-13-17-21-25-26(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4/h5-24H2,1-4H3 |
| InChIKey | RRIWSJIVUQYYMQ-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexoxy(trihexyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexoxy(trihexyl)silane?
The IUPAC name of hexoxy(trihexyl)silane (CID 533027) is hexoxy(trihexyl)silane.
What is the SMILES notation for hexoxy(trihexyl)silane?
The canonical SMILES for hexoxy(trihexyl)silane is CCCCCCO[Si](CCCCCC)(CCCCCC)CCCCCC.
What is the InChIKey of hexoxy(trihexyl)silane?
The InChIKey is RRIWSJIVUQYYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H52OSi/c1-5-9-13-17-21-25-26(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4/h5-24H2,1-4H3.
What are the key properties of hexoxy(trihexyl)silane?
hexoxy(trihexyl)silane has a molecular weight of 384.77 g/mol, XLogP of 9.27, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexoxy(trihexyl)silane is sourced from PubChem (CID 533027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).