C15H20ClN3O2 — CID 53302995
N-(2-chloro-6-nitrophenyl)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 53302995) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is N-(2-chloro-6-nitrophenyl)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | N-(2-chloro-6-nitrophenyl)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 53302995 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-(2-chloro-6-nitrophenyl)-9-methyl-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | CN1C2CCCC1CC(Nc1c(Cl)cccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C15H20ClN3O2/c1-18-11-4-2-5-12(18)9-10(8-11)17-15-13(16)6-3-7-14(15)19(20)21/h3,6-7,10-12,17H,2,4-5,8-9H2,1H3 |
| InChIKey | SEIBHGBROVIFMB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|