C13H14ClN5O2 — CID 166278833
2-chloro-6-nitro-N-[3-(1,2,4-triazol-1-ylmethyl)cyclobutyl]aniline (PubChem CID 166278833) has the molecular formula C13H14ClN5O2 and a molecular weight of 307.74 g/mol. Its IUPAC name is 2-chloro-6-nitro-N-[3-(1,2,4-triazol-1-ylmethyl)cyclobutyl]aniline.
| Compound Name | 2-chloro-6-nitro-N-[3-(1,2,4-triazol-1-ylmethyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 166278833 |
| Molecular Formula | C13H14ClN5O2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-chloro-6-nitro-N-[3-(1,2,4-triazol-1-ylmethyl)cyclobutyl]aniline |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1NC1CC(Cn2cncn2)C1 |
| InChI | InChI=1S/C13H14ClN5O2/c14-11-2-1-3-12(19(20)21)13(11)17-10-4-9(5-10)6-18-8-15-7-16-18/h1-3,7-10,17H,4-6H2 |
| InChIKey | RPLARVFLCJLFQR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|