C23H27ClN6O — CID 5330351
2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5330351) has the molecular formula C23H27ClN6O and a molecular weight of 438.96 g/mol. Its IUPAC name is 2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5330351 |
| Molecular Formula | C23H27ClN6O |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-(3-chloro-4-piperazin-1-ylanilino)-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCNCC4)c(Cl)c3)ncc12 |
| InChI | InChI=1S/C23H27ClN6O/c1-15-12-21(31)30(17-4-2-3-5-17)22-18(15)14-26-23(28-22)27-16-6-7-20(19(24)13-16)29-10-8-25-9-11-29/h6-7,12-14,17,25H,2-5,8-11H2,1H3,(H,26,27,28) |
| InChIKey | XZYIYZYWEWKEQK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|