C22H28ClNO2 — CID 53304031
6-[(4-chlorophenyl)methyl]-4-(2-methylcyclohexyl)oxy-3-propan-2-yl-1H-pyridin-2-one (PubChem CID 53304031) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-4-(2-methylcyclohexyl)oxy-3-propan-2-yl-1H-pyridin-2-one.
| Compound Name | 6-[(4-chlorophenyl)methyl]-4-(2-methylcyclohexyl)oxy-3-propan-2-yl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 53304031 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-4-(2-methylcyclohexyl)oxy-3-propan-2-yl-1H-pyridin-2-one |
| SMILES | CC(C)c1c(OC2CCCCC2C)cc(Cc2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C22H28ClNO2/c1-14(2)21-20(26-19-7-5-4-6-15(19)3)13-18(24-22(21)25)12-16-8-10-17(23)11-9-16/h8-11,13-15,19H,4-7,12H2,1-3H3,(H,24,25) |
| InChIKey | BPUZMPXCUWYQIB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |