C9H14O3 — CID 53304905
(5S,6S)-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one (PubChem CID 53304905) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (5S,6S)-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one.
| Compound Name | (5S,6S)-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 53304905 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (5S,6S)-5-(methoxymethoxy)-6-methylcyclohex-2-en-1-one |
| SMILES | COCO[C@H]1CC=CC(=O)[C@H]1C |
| InChI | InChI=1S/C9H14O3/c1-7-8(10)4-3-5-9(7)12-6-11-2/h3-4,7,9H,5-6H2,1-2H3/t7-,9+/m1/s1 |
| InChIKey | JXQFOQVXZGDBDI-APPZFPTMSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|