C16H30O3 — CID 20687575
(E)-8-ethyl-3,9-dimethoxy-2,4-dimethyldec-6-en-5-one (PubChem CID 20687575) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (E)-8-ethyl-3,9-dimethoxy-2,4-dimethyldec-6-en-5-one.
| Compound Name | (E)-8-ethyl-3,9-dimethoxy-2,4-dimethyldec-6-en-5-one |
|---|---|
| PubChem CID | 20687575 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (E)-8-ethyl-3,9-dimethoxy-2,4-dimethyldec-6-en-5-one |
| SMILES | CCC(/C=C/C(=O)C(C)C(OC)C(C)C)C(C)OC |
| InChI | InChI=1S/C16H30O3/c1-8-14(13(5)18-6)9-10-15(17)12(4)16(19-7)11(2)3/h9-14,16H,8H2,1-7H3/b10-9+ |
| InChIKey | NTCYLWLSGSZJHP-MDZDMXLPSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|