C14H26O3 — CID 59968474
(E,3R,4S,8S,9R)-8-ethyl-3,9-dihydroxy-2,4-dimethyldec-6-en-5-one (PubChem CID 59968474) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (E,3R,4S,8S,9R)-8-ethyl-3,9-dihydroxy-2,4-dimethyldec-6-en-5-one.
| Compound Name | (E,3R,4S,8S,9R)-8-ethyl-3,9-dihydroxy-2,4-dimethyldec-6-en-5-one |
|---|---|
| PubChem CID | 59968474 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (E,3R,4S,8S,9R)-8-ethyl-3,9-dihydroxy-2,4-dimethyldec-6-en-5-one |
| SMILES | CC[C@@H](/C=C/C(=O)[C@@H](C)[C@H](O)C(C)C)[C@@H](C)O |
| InChI | InChI=1S/C14H26O3/c1-6-12(11(5)15)7-8-13(16)10(4)14(17)9(2)3/h7-12,14-15,17H,6H2,1-5H3/b8-7+/t10-,11-,12+,14-/m1/s1 |
| InChIKey | SDEFVFYHHOJMAP-SXWSVNBLSA-N |
| XLogP | 2.17 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|