C13H20O3 — CID 146684499
(3S,6E,8E,10E)-1,3-dihydroxy-4-methyldodeca-6,8,10-trien-5-one (PubChem CID 146684499) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3S,6E,8E,10E)-1,3-dihydroxy-4-methyldodeca-6,8,10-trien-5-one.
| Compound Name | (3S,6E,8E,10E)-1,3-dihydroxy-4-methyldodeca-6,8,10-trien-5-one |
|---|---|
| PubChem CID | 146684499 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3S,6E,8E,10E)-1,3-dihydroxy-4-methyldodeca-6,8,10-trien-5-one |
| SMILES | C/C=C/C=C/C=C/C(=O)C(C)[C@@H](O)CCO |
| InChI | InChI=1S/C13H20O3/c1-3-4-5-6-7-8-12(15)11(2)13(16)9-10-14/h3-8,11,13-14,16H,9-10H2,1-2H3/b4-3+,6-5+,8-7+/t11?,13-/m0/s1 |
| InChIKey | AHQBPWBTLZUYGY-KFAZBBEMSA-N |
| XLogP | 1.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|