C23H12F4N4O — CID 5330642
(Z)-3-[2-amino-3-(2,6-difluorobenzoyl)imidazo[1,2-a]pyridin-6-yl]-3-(2,6-difluorophenyl)prop-2-enenitrile (PubChem CID 5330642) has the molecular formula C23H12F4N4O and a molecular weight of 436.37 g/mol. Its IUPAC name is (Z)-3-[2-amino-3-(2,6-difluorobenzoyl)imidazo[1,2-a]pyridin-6-yl]-3-(2,6-difluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-amino-3-(2,6-difluorobenzoyl)imidazo[1,2-a]pyridin-6-yl]-3-(2,6-difluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5330642 |
| Molecular Formula | C23H12F4N4O |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (Z)-3-[2-amino-3-(2,6-difluorobenzoyl)imidazo[1,2-a]pyridin-6-yl]-3-(2,6-difluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C=C(/c1ccc2nc(N)c(C(=O)c3c(F)cccc3F)n2c1)c1c(F)cccc1F |
| InChI | InChI=1S/C23H12F4N4O/c24-14-3-1-4-15(25)19(14)13(9-10-28)12-7-8-18-30-23(29)21(31(18)11-12)22(32)20-16(26)5-2-6-17(20)27/h1-9,11H,29H2/b13-9- |
| InChIKey | CRXBYOWJISXKAI-LCYFTJDESA-N |
| XLogP | 4.66 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|