C24H24O4 — CID 53307024
trans-[(1R)-1-(2-methoxyphenyl)prop-2-ynyl] (1R,2R)-2-benzoylcyclohexane-1-carboxylate (PubChem CID 53307024) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is trans-[(1R)-1-(2-methoxyphenyl)prop-2-ynyl] (1R,2R)-2-benzoylcyclohexane-1-carboxylate.
| Compound Name | trans-[(1R)-1-(2-methoxyphenyl)prop-2-ynyl] (1R,2R)-2-benzoylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 53307024 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | trans-[(1R)-1-(2-methoxyphenyl)prop-2-ynyl] (1R,2R)-2-benzoylcyclohexane-1-carboxylate |
| SMILES | C#C[C@@H](OC(=O)[C@@H]1CCCC[C@H]1C(=O)c1ccccc1)c1ccccc1OC |
| InChI | InChI=1S/C24H24O4/c1-3-21(20-15-9-10-16-22(20)27-2)28-24(26)19-14-8-7-13-18(19)23(25)17-11-5-4-6-12-17/h1,4-6,9-12,15-16,18-19,21H,7-8,13-14H2,2H3/t18-,19-,21-/m1/s1 |
| InChIKey | CQQFDNLZUAGSJN-SFHLNBCPSA-N |
| XLogP | 4.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|