C38H32O11 — CID 53307292
[4-[(Z)-2-[(2S,3S)-6-acetyloxy-2-(4-acetyloxyphenyl)-3-(3,5-diacetyloxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]ethenyl]phenyl] acetate (PubChem CID 53307292) has the molecular formula C38H32O11 and a molecular weight of 664.66 g/mol. Its IUPAC name is [4-[(Z)-2-[(2S,3S)-6-acetyloxy-2-(4-acetyloxyphenyl)-3-(3,5-diacetyloxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]ethenyl]phenyl] acetate.
| Compound Name | [4-[(Z)-2-[(2S,3S)-6-acetyloxy-2-(4-acetyloxyphenyl)-3-(3,5-diacetyloxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 53307292 |
| Molecular Formula | C38H32O11 |
| Molecular Weight | 664.66 g/mol |
| Exact Mass | 664.19 |
| IUPAC Name | [4-[(Z)-2-[(2S,3S)-6-acetyloxy-2-(4-acetyloxyphenyl)-3-(3,5-diacetyloxyphenyl)-2,3-dihydro-1-benzofuran-4-yl]ethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C\c2cc(OC(C)=O)cc3c2[C@H](c2cc(OC(C)=O)cc(OC(C)=O)c2)[C@@H](c2ccc(OC(C)=O)cc2)O3)cc1 |
| InChI | InChI=1S/C38H32O11/c1-21(39)44-30-12-7-26(8-13-30)6-9-28-16-34(48-25(5)43)20-35-36(28)37(38(49-35)27-10-14-31(15-11-27)45-22(2)40)29-17-32(46-23(3)41)19-33(18-29)47-24(4)42/h6-20,37-38H,1-5H3/b9-6-/t37-,38+/m0/s1 |
| InChIKey | LHVRYJIGNZCROE-REFJFEEGSA-N |
| XLogP | 6.75 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|