C40H34O14 — CID 46226511
[2-acetyloxy-4-[(2R,3R)-2-(3,5-diacetyloxyphenyl)-6-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]phenyl] acetate (PubChem CID 46226511) has the molecular formula C40H34O14 and a molecular weight of 738.70 g/mol. Its IUPAC name is [2-acetyloxy-4-[(2R,3R)-2-(3,5-diacetyloxyphenyl)-6-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]phenyl] acetate.
| Compound Name | [2-acetyloxy-4-[(2R,3R)-2-(3,5-diacetyloxyphenyl)-6-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]phenyl] acetate |
|---|---|
| PubChem CID | 46226511 |
| Molecular Formula | C40H34O14 |
| Molecular Weight | 738.70 g/mol |
| Exact Mass | 738.19 |
| IUPAC Name | [2-acetyloxy-4-[(2R,3R)-2-(3,5-diacetyloxyphenyl)-6-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]-2,3-dihydro-1,4-benzodioxin-3-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(/C=C/c2ccc3c(c2)O[C@H](c2ccc(OC(C)=O)c(OC(C)=O)c2)[C@@H](c2cc(OC(C)=O)cc(OC(C)=O)c2)O3)cc(OC(C)=O)c1 |
| InChI | InChI=1S/C40H34O14/c1-21(41)47-31-13-28(14-32(19-31)48-22(2)42)8-7-27-9-11-36-37(15-27)54-39(29-10-12-35(51-25(5)45)38(18-29)52-26(6)46)40(53-36)30-16-33(49-23(3)43)20-34(17-30)50-24(4)44/h7-20,39-40H,1-6H3/b8-7+/t39-,40-/m1/s1 |
| InChIKey | KAQQOVHKJUUWBV-WLGFPTLXSA-N |
| XLogP | 6.66 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.70 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|