C26H42O4SSi2 — CID 53308774
(1S,2R,6R,7R,8S)-8-(benzenesulfonyl)-6-methoxy-8-triethylsilyl-7-(2-trimethylsilylethynyl)bicyclo[4.2.0]octan-2-ol (PubChem CID 53308774) has the molecular formula C26H42O4SSi2 and a molecular weight of 506.86 g/mol. Its IUPAC name is (1S,2R,6R,7R,8S)-8-(benzenesulfonyl)-6-methoxy-8-triethylsilyl-7-(2-trimethylsilylethynyl)bicyclo[4.2.0]octan-2-ol.
| Compound Name | (1S,2R,6R,7R,8S)-8-(benzenesulfonyl)-6-methoxy-8-triethylsilyl-7-(2-trimethylsilylethynyl)bicyclo[4.2.0]octan-2-ol |
|---|---|
| PubChem CID | 53308774 |
| Molecular Formula | C26H42O4SSi2 |
| Molecular Weight | 506.86 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (1S,2R,6R,7R,8S)-8-(benzenesulfonyl)-6-methoxy-8-triethylsilyl-7-(2-trimethylsilylethynyl)bicyclo[4.2.0]octan-2-ol |
| SMILES | CC[Si](CC)(CC)[C@]1(S(=O)(=O)c2ccccc2)[C@H](C#C[Si](C)(C)C)[C@]2(OC)CCC[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C26H42O4SSi2/c1-8-33(9-2,10-3)26(31(28,29)21-15-12-11-13-16-21)23(18-20-32(5,6)7)25(30-4)19-14-17-22(27)24(25)26/h11-13,15-16,22-24,27H,8-10,14,17,19H2,1-7H3/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | IZUJJHCUVMQPSN-WSGIOKLISA-N |
| XLogP | 5.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|