C26H34O5SSi2 — CID 102257446
(1S,4R,5S,6S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octane-4,5-diol (PubChem CID 102257446) has the molecular formula C26H34O5SSi2 and a molecular weight of 514.79 g/mol. Its IUPAC name is (1S,4R,5S,6S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octane-4,5-diol.
| Compound Name | (1S,4R,5S,6S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octane-4,5-diol |
|---|---|
| PubChem CID | 102257446 |
| Molecular Formula | C26H34O5SSi2 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (1S,4R,5S,6S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octane-4,5-diol |
| SMILES | C[Si](C)(C)C#C[C@H]1[C@@H]2OC[C@@H](O)[C@@H](O)[C@@H]2[C@]1([Si](C)(C)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H34O5SSi2/c1-33(2,3)17-16-21-25-23(24(28)22(27)18-31-25)26(21,32(29,30)19-12-8-6-9-13-19)34(4,5)20-14-10-7-11-15-20/h6-15,21-25,27-28H,18H2,1-5H3/t21-,22+,23-,24+,25-,26-/m0/s1 |
| InChIKey | FWPBVHRPZZRFSW-HQJTZPOCSA-N |
| XLogP | 2.60 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|