C28H44O6SSi — CID 11191893
(1S,3R,5S,6R,8S,10S,12R)-6-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-10-methyl-2,7,13-trioxatricyclo[10.4.0.03,8]hexadecan-5-ol (PubChem CID 11191893) has the molecular formula C28H44O6SSi and a molecular weight of 536.81 g/mol. Its IUPAC name is (1S,3R,5S,6R,8S,10S,12R)-6-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-10-methyl-2,7,13-trioxatricyclo[10.4.0.03,8]hexadecan-5-ol.
| Compound Name | (1S,3R,5S,6R,8S,10S,12R)-6-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-10-methyl-2,7,13-trioxatricyclo[10.4.0.03,8]hexadecan-5-ol |
|---|---|
| PubChem CID | 11191893 |
| Molecular Formula | C28H44O6SSi |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (1S,3R,5S,6R,8S,10S,12R)-6-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-10-methyl-2,7,13-trioxatricyclo[10.4.0.03,8]hexadecan-5-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/[C@H]1O[C@H]2C[C@@H](C)C[C@H]3OCCC[C@@H]3O[C@@H]2C[C@@H]1O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H44O6SSi/c1-5-36(6-2,7-3)28(35(30,31)21-12-9-8-10-13-21)19-24-22(29)18-27-26(34-24)17-20(4)16-25-23(33-27)14-11-15-32-25/h8-10,12-13,19-20,22-27,29H,5-7,11,14-18H2,1-4H3/b28-19+/t20-,22-,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | LXRBMGSXMDAAMH-WBUNKOKFSA-N |
| XLogP | 5.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|