C23H26O5SSi — CID 138980721
(4R,5S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-ethynyl-2-oxabicyclo[4.2.0]octane-4,5-diol (PubChem CID 138980721) has the molecular formula C23H26O5SSi and a molecular weight of 442.61 g/mol. Its IUPAC name is (4R,5S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-ethynyl-2-oxabicyclo[4.2.0]octane-4,5-diol.
| Compound Name | (4R,5S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-ethynyl-2-oxabicyclo[4.2.0]octane-4,5-diol |
|---|---|
| PubChem CID | 138980721 |
| Molecular Formula | C23H26O5SSi |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (4R,5S,7R,8S)-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-ethynyl-2-oxabicyclo[4.2.0]octane-4,5-diol |
| SMILES | C#C[C@H]1C2OC[C@@H](O)C(O)C2[C@]1([Si](C)(C)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26O5SSi/c1-4-18-22-20(21(25)19(24)15-28-22)23(18,29(26,27)16-11-7-5-8-12-16)30(2,3)17-13-9-6-10-14-17/h1,5-14,18-22,24-25H,15H2,2-3H3/t18-,19+,20?,21?,22?,23-/m0/s1 |
| InChIKey | SVGQWVFFTUAMNY-QFWKPHBLSA-N |
| XLogP | 1.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|