C30H38O7SSi2 — CID 102257448
[(1S,4R,5S,6R,7R,8S)-5-acetyloxy-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octan-4-yl] acetate (PubChem CID 102257448) has the molecular formula C30H38O7SSi2 and a molecular weight of 598.87 g/mol. Its IUPAC name is [(1S,4R,5S,6R,7R,8S)-5-acetyloxy-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octan-4-yl] acetate.
| Compound Name | [(1S,4R,5S,6R,7R,8S)-5-acetyloxy-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octan-4-yl] acetate |
|---|---|
| PubChem CID | 102257448 |
| Molecular Formula | C30H38O7SSi2 |
| Molecular Weight | 598.87 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | [(1S,4R,5S,6R,7R,8S)-5-acetyloxy-7-(benzenesulfonyl)-7-[dimethyl(phenyl)silyl]-8-(2-trimethylsilylethynyl)-2-oxabicyclo[4.2.0]octan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2[C@@H](OC[C@H]1OC(C)=O)[C@H](C#C[Si](C)(C)C)[C@@]2([Si](C)(C)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H38O7SSi2/c1-21(31)36-26-20-35-28-25(18-19-39(3,4)5)30(27(28)29(26)37-22(2)32,38(33,34)23-14-10-8-11-15-23)40(6,7)24-16-12-9-13-17-24/h8-17,25-29H,20H2,1-7H3/t25-,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | NZNPMWDFSGAPHD-FKZASGQMSA-N |
| XLogP | 3.74 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|