C31H46O5SSi2 — CID 135012279
(1S)-1-[(1S,2S,3S,4R)-2-(benzenesulfonyl)-4-(hydroxymethyl)-2-triethylsilyl-3-(2-trimethylsilylethynyl)cyclobutyl]-2-phenylmethoxyethanol (PubChem CID 135012279) has the molecular formula C31H46O5SSi2 and a molecular weight of 586.94 g/mol. Its IUPAC name is (1S)-1-[(1S,2S,3S,4R)-2-(benzenesulfonyl)-4-(hydroxymethyl)-2-triethylsilyl-3-(2-trimethylsilylethynyl)cyclobutyl]-2-phenylmethoxyethanol.
| Compound Name | (1S)-1-[(1S,2S,3S,4R)-2-(benzenesulfonyl)-4-(hydroxymethyl)-2-triethylsilyl-3-(2-trimethylsilylethynyl)cyclobutyl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 135012279 |
| Molecular Formula | C31H46O5SSi2 |
| Molecular Weight | 586.94 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | (1S)-1-[(1S,2S,3S,4R)-2-(benzenesulfonyl)-4-(hydroxymethyl)-2-triethylsilyl-3-(2-trimethylsilylethynyl)cyclobutyl]-2-phenylmethoxyethanol |
| SMILES | CC[Si](CC)(CC)[C@@]1(S(=O)(=O)c2ccccc2)[C@H]([C@H](O)COCc2ccccc2)[C@H](CO)[C@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C31H46O5SSi2/c1-7-39(8-2,9-3)31(37(34,35)26-18-14-11-15-19-26)28(20-21-38(4,5)6)27(22-32)30(31)29(33)24-36-23-25-16-12-10-13-17-25/h10-19,27-30,32-33H,7-9,22-24H2,1-6H3/t27-,28-,29-,30+,31-/m1/s1 |
| InChIKey | WRFJGVJTMUTUIV-NZUWZFMJSA-N |
| XLogP | 5.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.94 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|