C28H34O4S — CID 10253993
(1S,2R,7S)-3-(benzenesulfonyl)-2-hept-1-ynyl-7-methyl-7-phenylmethoxycyclohept-3-en-1-ol (PubChem CID 10253993) has the molecular formula C28H34O4S and a molecular weight of 466.64 g/mol. Its IUPAC name is (1S,2R,7S)-3-(benzenesulfonyl)-2-hept-1-ynyl-7-methyl-7-phenylmethoxycyclohept-3-en-1-ol.
| Compound Name | (1S,2R,7S)-3-(benzenesulfonyl)-2-hept-1-ynyl-7-methyl-7-phenylmethoxycyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 10253993 |
| Molecular Formula | C28H34O4S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (1S,2R,7S)-3-(benzenesulfonyl)-2-hept-1-ynyl-7-methyl-7-phenylmethoxycyclohept-3-en-1-ol |
| SMILES | CCCCCC#C[C@H]1C(S(=O)(=O)c2ccccc2)=CCC[C@](C)(OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C28H34O4S/c1-3-4-5-6-13-19-25-26(33(30,31)24-17-11-8-12-18-24)20-14-21-28(2,27(25)29)32-22-23-15-9-7-10-16-23/h7-12,15-18,20,25,27,29H,3-6,14,21-22H2,1-2H3/t25-,27-,28-/m0/s1 |
| InChIKey | BHSUAKAKSAAIRG-MYKRZTLLSA-N |
| XLogP | 5.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|