C29H40O5SSi — CID 11409962
(2R,3S,5R,6S)-2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-5-phenylmethoxy-6-prop-2-enyloxan-3-ol (PubChem CID 11409962) has the molecular formula C29H40O5SSi and a molecular weight of 528.79 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-5-phenylmethoxy-6-prop-2-enyloxan-3-ol.
| Compound Name | (2R,3S,5R,6S)-2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-5-phenylmethoxy-6-prop-2-enyloxan-3-ol |
|---|---|
| PubChem CID | 11409962 |
| Molecular Formula | C29H40O5SSi |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | (2R,3S,5R,6S)-2-[(Z)-2-(benzenesulfonyl)-2-triethylsilylethenyl]-5-phenylmethoxy-6-prop-2-enyloxan-3-ol |
| SMILES | C=CC[C@@H]1O[C@H](/C=C(/[Si](CC)(CC)CC)S(=O)(=O)c2ccccc2)[C@@H](O)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H40O5SSi/c1-5-15-26-28(33-22-23-16-11-9-12-17-23)20-25(30)27(34-26)21-29(36(6-2,7-3)8-4)35(31,32)24-18-13-10-14-19-24/h5,9-14,16-19,21,25-28,30H,1,6-8,15,20,22H2,2-4H3/b29-21+/t25-,26-,27+,28+/m0/s1 |
| InChIKey | FKVXAXBNVPFCJW-QLRGFEPESA-N |
| XLogP | 6.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|