C28H32O5SSi — CID 135012661
(Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-en-1-ol (PubChem CID 135012661) has the molecular formula C28H32O5SSi and a molecular weight of 508.71 g/mol. Its IUPAC name is (Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-en-1-ol.
| Compound Name | (Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 135012661 |
| Molecular Formula | C28H32O5SSi |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | (Z,2S)-4-(benzenesulfonyl)-4-[dimethyl(phenyl)silyl]-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-en-1-ol |
| SMILES | C[Si](C)(/C(=C/[C@@H](CO)[C@@H]1O[C@H]1COCc1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O5SSi/c1-35(2,25-16-10-5-11-17-25)27(34(30,31)24-14-8-4-9-15-24)18-23(19-29)28-26(33-28)21-32-20-22-12-6-3-7-13-22/h3-18,23,26,28-29H,19-21H2,1-2H3/b27-18+/t23-,26-,28-/m0/s1 |
| InChIKey | BKACGQOXYXNPRN-JXUALLCWSA-N |
| XLogP | 4.09 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|