C26H28O6S — CID 134878492
(2R,3S,4R,6R)-6-(benzenesulfonyl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 134878492) has the molecular formula C26H28O6S and a molecular weight of 468.57 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-(benzenesulfonyl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2R,3S,4R,6R)-6-(benzenesulfonyl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 134878492 |
| Molecular Formula | C26H28O6S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (2R,3S,4R,6R)-6-(benzenesulfonyl)-4-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1C[C@@H](OCc2ccccc2)[C@H](O)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C26H28O6S/c27-26-23(31-18-21-12-6-2-7-13-21)16-25(33(28,29)22-14-8-3-9-15-22)32-24(26)19-30-17-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24-,25-,26+/m1/s1 |
| InChIKey | UADPBRBPQCNPBN-POTDNYQPSA-N |
| XLogP | 3.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |