C24H26O5S — CID 56837658
(1R,2S)-1-(4-methylsulfonylphenyl)-1,3-bis(phenylmethoxy)propan-2-ol (PubChem CID 56837658) has the molecular formula C24H26O5S and a molecular weight of 426.53 g/mol. Its IUPAC name is (1R,2S)-1-(4-methylsulfonylphenyl)-1,3-bis(phenylmethoxy)propan-2-ol.
| Compound Name | (1R,2S)-1-(4-methylsulfonylphenyl)-1,3-bis(phenylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 56837658 |
| Molecular Formula | C24H26O5S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (1R,2S)-1-(4-methylsulfonylphenyl)-1,3-bis(phenylmethoxy)propan-2-ol |
| SMILES | CS(=O)(=O)c1ccc([C@@H](OCc2ccccc2)[C@@H](O)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26O5S/c1-30(26,27)22-14-12-21(13-15-22)24(29-17-20-10-6-3-7-11-20)23(25)18-28-16-19-8-4-2-5-9-19/h2-15,23-25H,16-18H2,1H3/t23-,24+/m0/s1 |
| InChIKey | LVXFGMCGWCBPQP-BJKOFHAPSA-N |
| XLogP | 3.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |