C28H34O4SSi — CID 15401361
[4-[dimethyl(phenyl)silyl]-1-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 15401361) has the molecular formula C28H34O4SSi and a molecular weight of 494.73 g/mol. Its IUPAC name is [4-[dimethyl(phenyl)silyl]-1-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-[dimethyl(phenyl)silyl]-1-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15401361 |
| Molecular Formula | C28H34O4SSi |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [4-[dimethyl(phenyl)silyl]-1-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | C=CC(CC(COCc1ccccc1)OS(=O)(=O)c1ccc(C)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H34O4SSi/c1-5-27(34(3,4)28-14-10-7-11-15-28)20-25(22-31-21-24-12-8-6-9-13-24)32-33(29,30)26-18-16-23(2)17-19-26/h5-19,25,27H,1,20-22H2,2-4H3 |
| InChIKey | AEHDNTSUKNGHLT-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|