C19H22O4S — CID 15421522
(E)-4-(benzenesulfonyl)-1-phenylmethoxyhex-4-en-2-ol (PubChem CID 15421522) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (E)-4-(benzenesulfonyl)-1-phenylmethoxyhex-4-en-2-ol.
| Compound Name | (E)-4-(benzenesulfonyl)-1-phenylmethoxyhex-4-en-2-ol |
|---|---|
| PubChem CID | 15421522 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (E)-4-(benzenesulfonyl)-1-phenylmethoxyhex-4-en-2-ol |
| SMILES | C/C=C(\CC(O)COCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22O4S/c1-2-18(24(21,22)19-11-7-4-8-12-19)13-17(20)15-23-14-16-9-5-3-6-10-16/h2-12,17,20H,13-15H2,1H3/b18-2+ |
| InChIKey | FBGQMDJUPYFWFI-LPRJTOQXSA-N |
| XLogP | 3.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |