C25H36O6SSi — CID 11145441
[(2R,3R,4R)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyoxan-2-yl]methanol (PubChem CID 11145441) has the molecular formula C25H36O6SSi and a molecular weight of 492.71 g/mol. Its IUPAC name is [(2R,3R,4R)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 11145441 |
| Molecular Formula | C25H36O6SSi |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | [(2R,3R,4R)-6-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyoxan-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(S(=O)(=O)c2ccccc2)O[C@H](CO)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H36O6SSi/c1-25(2,3)33(4,5)31-21-16-23(32(27,28)20-14-10-7-11-15-20)30-22(17-26)24(21)29-18-19-12-8-6-9-13-19/h6-15,21-24,26H,16-18H2,1-5H3/t21-,22-,23?,24+/m1/s1 |
| InChIKey | CMJCCCVNDAQUJD-LBJGMLRWSA-N |
| XLogP | 4.54 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|