C27H30O2SSi — CID 10599513
6-[dimethyl(phenyl)silyl]-1-phenylmethoxy-4-phenylsulfanylhex-5-yn-2-ol (PubChem CID 10599513) has the molecular formula C27H30O2SSi and a molecular weight of 446.69 g/mol. Its IUPAC name is 6-[dimethyl(phenyl)silyl]-1-phenylmethoxy-4-phenylsulfanylhex-5-yn-2-ol.
| Compound Name | 6-[dimethyl(phenyl)silyl]-1-phenylmethoxy-4-phenylsulfanylhex-5-yn-2-ol |
|---|---|
| PubChem CID | 10599513 |
| Molecular Formula | C27H30O2SSi |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 6-[dimethyl(phenyl)silyl]-1-phenylmethoxy-4-phenylsulfanylhex-5-yn-2-ol |
| SMILES | C[Si](C)(C#CC(CC(O)COCc1ccccc1)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O2SSi/c1-31(2,27-16-10-5-11-17-27)19-18-26(30-25-14-8-4-9-15-25)20-24(28)22-29-21-23-12-6-3-7-13-23/h3-17,24,26,28H,20-22H2,1-2H3 |
| InChIKey | WJCKCTOIOSWEST-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|