C33H42O5SSi2 — CID 135012278
[(1R,2R,3S,4S)-3-(benzenesulfonyl)-2-[(1R)-1-[dimethyl(phenyl)silyl]oxy-2-phenylmethoxyethyl]-4-(2-trimethylsilylethynyl)cyclobutyl]methanol (PubChem CID 135012278) has the molecular formula C33H42O5SSi2 and a molecular weight of 606.93 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-3-(benzenesulfonyl)-2-[(1R)-1-[dimethyl(phenyl)silyl]oxy-2-phenylmethoxyethyl]-4-(2-trimethylsilylethynyl)cyclobutyl]methanol.
| Compound Name | [(1R,2R,3S,4S)-3-(benzenesulfonyl)-2-[(1R)-1-[dimethyl(phenyl)silyl]oxy-2-phenylmethoxyethyl]-4-(2-trimethylsilylethynyl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 135012278 |
| Molecular Formula | C33H42O5SSi2 |
| Molecular Weight | 606.93 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | [(1R,2R,3S,4S)-3-(benzenesulfonyl)-2-[(1R)-1-[dimethyl(phenyl)silyl]oxy-2-phenylmethoxyethyl]-4-(2-trimethylsilylethynyl)cyclobutyl]methanol |
| SMILES | C[Si](C)(C)C#C[C@@H]1[C@@H](CO)[C@H]([C@H](COCc2ccccc2)O[Si](C)(C)c2ccccc2)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H42O5SSi2/c1-40(2,3)22-21-29-30(23-34)32(33(29)39(35,36)27-17-11-7-12-18-27)31(25-37-24-26-15-9-6-10-16-26)38-41(4,5)28-19-13-8-14-20-28/h6-20,29-34H,23-25H2,1-5H3/t29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | OPOIZQODZZSLHF-AALIFHQRSA-N |
| XLogP | 5.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.93 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|