C32H42N6O7 — CID 53310224
[(1S)-1-[(5S,6S,7S,8R,9R)-7-azido-8-(dimethylcarbamoylamino)-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate (PubChem CID 53310224) has the molecular formula C32H42N6O7 and a molecular weight of 622.72 g/mol. Its IUPAC name is [(1S)-1-[(5S,6S,7S,8R,9R)-7-azido-8-(dimethylcarbamoylamino)-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate.
| Compound Name | [(1S)-1-[(5S,6S,7S,8R,9R)-7-azido-8-(dimethylcarbamoylamino)-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 53310224 |
| Molecular Formula | C32H42N6O7 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | [(1S)-1-[(5S,6S,7S,8R,9R)-7-azido-8-(dimethylcarbamoylamino)-9-hydroxy-2,2,9-trimethyl-6-(3-prop-1-en-2-ylanilino)-1,3-dioxaspiro[4.4]nonan-8-yl]ethyl] 4-methoxybenzoate |
| SMILES | C=C(C)c1cccc(N[C@H]2[C@H](N=[N+]=[N-])[C@@](NC(=O)N(C)C)([C@H](C)OC(=O)c3ccc(OC)cc3)[C@@](C)(O)[C@@]23COC(C)(C)O3)c1 |
| InChI | InChI=1S/C32H42N6O7/c1-19(2)22-11-10-12-23(17-22)34-25-26(36-37-33)32(35-28(40)38(7)8,30(6,41)31(25)18-43-29(4,5)45-31)20(3)44-27(39)21-13-15-24(42-9)16-14-21/h10-17,20,25-26,34,41H,1,18H2,2-9H3,(H,35,40)/t20-,25-,26-,30-,31+,32-/m0/s1 |
| InChIKey | ZREKMPIBIIEJDH-DXQATQMHSA-N |
| XLogP | 4.73 |
| TPSA | 167.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|