C11H15NO — CID 53310337
(5R)-1-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohex-2-ene-1-carbonitrile (PubChem CID 53310337) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (5R)-1-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohex-2-ene-1-carbonitrile.
| Compound Name | (5R)-1-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohex-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 53310337 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (5R)-1-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohex-2-ene-1-carbonitrile |
| SMILES | C=C(C)[C@@H]1CC=C(C)C(O)(C#N)C1 |
| InChI | InChI=1S/C11H15NO/c1-8(2)10-5-4-9(3)11(13,6-10)7-12/h4,10,13H,1,5-6H2,2-3H3/t10-,11?/m1/s1 |
| InChIKey | DQRHJHLDDKOVRG-NFJWQWPMSA-N |
| XLogP | 2.17 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|