C29H34NOSi+ — CID 53310428
[diphenyl-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane (PubChem CID 53310428) has the molecular formula C29H34NOSi+ and a molecular weight of 440.68 g/mol. Its IUPAC name is [diphenyl-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane.
| Compound Name | [diphenyl-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 53310428 |
| Molecular Formula | C29H34NOSi+ |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | [diphenyl-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)C1CCC/[N+]1=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C29H34NOSi/c1-32(2,3)31-29(26-18-9-5-10-19-26,27-20-11-6-12-21-27)28-22-14-24-30(28)23-13-17-25-15-7-4-8-16-25/h4-13,15-21,23,28H,14,22,24H2,1-3H3/q+1/b17-13+,30-23+ |
| InChIKey | WVUQNVUZCFOJIQ-KQOHYSIGSA-N |
| XLogP | 6.74 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|