C29H30F12NOSi+ — CID 134941842
[(S)-[2,4-bis(trifluoromethyl)phenyl]-[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(E)-pent-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane (PubChem CID 134941842) has the molecular formula C29H30F12NOSi+ and a molecular weight of 664.63 g/mol. Its IUPAC name is [(S)-[2,4-bis(trifluoromethyl)phenyl]-[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(E)-pent-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane.
| Compound Name | [(S)-[2,4-bis(trifluoromethyl)phenyl]-[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(E)-pent-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 134941842 |
| Molecular Formula | C29H30F12NOSi+ |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 664.19 |
| IUPAC Name | [(S)-[2,4-bis(trifluoromethyl)phenyl]-[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(E)-pent-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
| SMILES | CC/C=C/C=[N+]1\CCC[C@H]1[C@](O[Si](C)(C)C)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C29H30F12NOSi/c1-5-6-7-12-42-13-8-9-24(42)25(43-44(2,3)4,19-14-20(27(33,34)35)16-21(15-19)28(36,37)38)22-11-10-18(26(30,31)32)17-23(22)29(39,40)41/h6-7,10-12,14-17,24H,5,8-9,13H2,1-4H3/q+1/b7-6+,42-12+/t24-,25-/m0/s1 |
| InChIKey | LYTJTMQMQBEDIL-IFVZTNABSA-N |
| XLogP | 10.07 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|