C33H30F12NOSi+ — CID 101482558
[bis[3,5-bis(trifluoromethyl)phenyl]-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane (PubChem CID 101482558) has the molecular formula C33H30F12NOSi+ and a molecular weight of 712.67 g/mol. Its IUPAC name is [bis[3,5-bis(trifluoromethyl)phenyl]-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane.
| Compound Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 101482558 |
| Molecular Formula | C33H30F12NOSi+ |
| Molecular Weight | 712.67 g/mol |
| Exact Mass | 712.19 |
| IUPAC Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCC/[N+]1=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C33H30F12NOSi/c1-48(2,3)47-29(22-15-24(30(34,35)36)19-25(16-22)31(37,38)39,23-17-26(32(40,41)42)20-27(18-23)33(43,44)45)28-12-8-14-46(28)13-7-11-21-9-5-4-6-10-21/h4-7,9-11,13,15-20,28H,8,12,14H2,1-3H3/q+1/b11-7+,46-13+ |
| InChIKey | JVIBHQYMKJBBNX-KFWZTOGGSA-N |
| XLogP | 10.82 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.67 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|