C32H40NOSi+ — CID 154707791
tert-butyl-[diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-dimethylsilane (PubChem CID 154707791) has the molecular formula C32H40NOSi+ and a molecular weight of 482.76 g/mol. Its IUPAC name is tert-butyl-[diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154707791 |
| Molecular Formula | C32H40NOSi+ |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | tert-butyl-[diphenyl-[(2S)-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@@H]1CCC/[N+]1=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C32H40NOSi/c1-31(2,3)35(4,5)34-32(28-20-11-7-12-21-28,29-22-13-8-14-23-29)30-24-16-26-33(30)25-15-19-27-17-9-6-10-18-27/h6-15,17-23,25,30H,16,24,26H2,1-5H3/q+1/b19-15+,33-25+/t30-/m0/s1 |
| InChIKey | ANAIFGGLCVZPCZ-XMMHYLJNSA-N |
| XLogP | 7.91 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|