C23H32NOSi+ — CID 53310429
[diphenyl-(1-propylidenepyrrolidin-1-ium-2-yl)methoxy]-trimethylsilane (PubChem CID 53310429) has the molecular formula C23H32NOSi+ and a molecular weight of 366.60 g/mol. Its IUPAC name is [diphenyl-(1-propylidenepyrrolidin-1-ium-2-yl)methoxy]-trimethylsilane.
| Compound Name | [diphenyl-(1-propylidenepyrrolidin-1-ium-2-yl)methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 53310429 |
| Molecular Formula | C23H32NOSi+ |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [diphenyl-(1-propylidenepyrrolidin-1-ium-2-yl)methoxy]-trimethylsilane |
| SMILES | CC/C=[N+]1\CCCC1C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32NOSi/c1-5-18-24-19-12-17-22(24)23(25-26(2,3)4,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16,18,22H,5,12,17,19H2,1-4H3/q+1/b24-18+ |
| InChIKey | DFGCHRSZJZWXMK-HKOYGPOVSA-N |
| XLogP | 5.44 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|