C16H10BrN3O3 — CID 5331108
2-bromo-9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (PubChem CID 5331108) has the molecular formula C16H10BrN3O3 and a molecular weight of 372.18 g/mol. Its IUPAC name is 2-bromo-9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one.
| Compound Name | 2-bromo-9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 5331108 |
| Molecular Formula | C16H10BrN3O3 |
| Molecular Weight | 372.18 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2-bromo-9-nitro-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| SMILES | O=C1Cc2c([nH]c3ccc([N+](=O)[O-])cc23)-c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C16H10BrN3O3/c17-8-1-3-14-12(5-8)16-11(7-15(21)18-14)10-6-9(20(22)23)2-4-13(10)19-16/h1-6,19H,7H2,(H,18,21) |
| InChIKey | IAJGQMXAKJOLBA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|