C21H24ClN7OS — CID 53312307
N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 53312307) has the molecular formula C21H24ClN7OS and a molecular weight of 469.06 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 53312307 |
| Molecular Formula | C21H24ClN7OS |
| Molecular Weight | 469.06 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[2-methyl-6-[2,2,3,3,5,5,6,6-octadeuterio-4-(trideuteriomethyl)piperazin-1-yl]pyrimidin-4-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | [2H]C([2H])([2H])N1C([2H])([2H])C([2H])([2H])N(c2cc(Nc3ncc(C(=O)Nc4c(C)cccc4Cl)s3)nc(C)n2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C21H24ClN7OS/c1-13-5-4-6-15(22)19(13)27-20(30)16-12-23-21(31-16)26-17-11-18(25-14(2)24-17)29-9-7-28(3)8-10-29/h4-6,11-12H,7-10H2,1-3H3,(H,27,30)(H,23,24,25,26)/i3D3,7D2,8D2,9D2,10D2 |
| InChIKey | IJEYJOYHXCYZGO-MLWZEJJPSA-N |
| XLogP | 3.95 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.06 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |