C17H31ClNO- — CID 53313645
2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol chloride (PubChem CID 53313645) has the molecular formula C17H31ClNO- and a molecular weight of 300.89 g/mol. Its IUPAC name is 2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol chloride.
| Compound Name | 2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol chloride |
|---|---|
| PubChem CID | 53313645 |
| Molecular Formula | C17H31ClNO- |
| Molecular Weight | 300.89 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 2-(1-adamantyl)-2-(2,2-dimethylpropylamino)ethanol chloride |
| SMILES | CC(C)(C)CNC(CO)C12CC3CC(CC(C3)C1)C2.[Cl-] |
| InChI | InChI=1S/C17H31NO.ClH/c1-16(2,3)11-18-15(10-19)17-7-12-4-13(8-17)6-14(5-12)9-17;/h12-15,18-19H,4-11H2,1-3H3;1H/p-1 |
| InChIKey | VFHQPLSGRWTVAS-UHFFFAOYSA-M |
| XLogP | 0.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.89 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |