C17H32N6 — CID 53315797
N',N'-dimethyl-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine (PubChem CID 53315797) has the molecular formula C17H32N6 and a molecular weight of 320.49 g/mol. Its IUPAC name is N',N'-dimethyl-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine.
| Compound Name | N',N'-dimethyl-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 53315797 |
| Molecular Formula | C17H32N6 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | N',N'-dimethyl-N-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]hexane-1,6-diamine |
| SMILES | CN(C)CCCCCCNc1cc(N2CCN(C)CC2)ncn1 |
| InChI | InChI=1S/C17H32N6/c1-21(2)9-7-5-4-6-8-18-16-14-17(20-15-19-16)23-12-10-22(3)11-13-23/h14-15H,4-13H2,1-3H3,(H,18,19,20) |
| InChIKey | GMUFOTNNGVEDHN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|