C28H47N3O3 — CID 53316899
tert-butyl N-[7-[[1-(2-phenylethyl)piperidin-4-yl]-propanoylamino]heptyl]carbamate (PubChem CID 53316899) has the molecular formula C28H47N3O3 and a molecular weight of 473.70 g/mol. Its IUPAC name is tert-butyl N-[7-[[1-(2-phenylethyl)piperidin-4-yl]-propanoylamino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[[1-(2-phenylethyl)piperidin-4-yl]-propanoylamino]heptyl]carbamate |
|---|---|
| PubChem CID | 53316899 |
| Molecular Formula | C28H47N3O3 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.36 |
| IUPAC Name | tert-butyl N-[7-[[1-(2-phenylethyl)piperidin-4-yl]-propanoylamino]heptyl]carbamate |
| SMILES | CCC(=O)N(CCCCCCCNC(=O)OC(C)(C)C)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H47N3O3/c1-5-26(32)31(20-13-8-6-7-12-19-29-27(33)34-28(2,3)4)25-17-22-30(23-18-25)21-16-24-14-10-9-11-15-24/h9-11,14-15,25H,5-8,12-13,16-23H2,1-4H3,(H,29,33) |
| InChIKey | WLHGRWQICUUWGP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|