C26H41N3O — CID 45210433
1-[1-(5-methylhex-5-en-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 45210433) has the molecular formula C26H41N3O and a molecular weight of 411.63 g/mol. Its IUPAC name is 1-[1-(5-methylhex-5-en-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(5-methylhex-5-en-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45210433 |
| Molecular Formula | C26H41N3O |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | 1-[1-(5-methylhex-5-en-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | C=C(C)CCC(C)N1CCC(N2CCC(C(=O)NCCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C26H41N3O/c1-21(2)9-10-22(3)28-19-14-25(15-20-28)29-17-12-24(13-18-29)26(30)27-16-11-23-7-5-4-6-8-23/h4-8,22,24-25H,1,9-20H2,2-3H3,(H,27,30) |
| InChIKey | YOPKSOBTIYZVAH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|