About amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate
amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 53317583) has the molecular formula C19H22F2N4O2
and a molecular weight of 376.41 g/mol. Its IUPAC name is amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate |
| PubChem CID | 53317583 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | NOC(=O)c1cncc(N2CCC([C@H](N)Cc3cc(F)ccc3F)CC2)c1 |
| InChI | InChI=1S/C19H22F2N4O2/c20-15-1-2-17(21)13(7-15)9-18(22)12-3-5-25(6-4-12)16-8-14(10-24-11-16)19(26)27-23/h1-2,7-8,10-12,18H,3-6,9,22-23H2/t18-/m1/s1 |
| InChIKey | FGSRUDZYLYKIIO-GOSISDBHSA-N |
| XLogP | 2.18 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
The IUPAC name of amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate (CID 53317583) is amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate.
What is the SMILES notation for amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
The canonical SMILES for amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate is NOC(=O)c1cncc(N2CCC([C@H](N)Cc3cc(F)ccc3F)CC2)c1.
What is the InChIKey of amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
The InChIKey is FGSRUDZYLYKIIO-GOSISDBHSA-N. The full InChI is InChI=1S/C19H22F2N4O2/c20-15-1-2-17(21)13(7-15)9-18(22)12-3-5-25(6-4-12)16-8-14(10-24-11-16)19(26)27-23/h1-2,7-8,10-12,18H,3-6,9,22-23H2/t18-/m1/s1.
What are the key properties of amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate?
amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate has a molecular weight of 376.41 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino 5-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]pyridine-3-carboxylate is sourced from PubChem (CID 53317583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).