C24H27F5N2O — CID 143151105
(2E,4E)-1-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4,6-trien-1-one (PubChem CID 143151105) has the molecular formula C24H27F5N2O and a molecular weight of 454.48 g/mol. Its IUPAC name is (2E,4E)-1-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4,6-trien-1-one.
| Compound Name | (2E,4E)-1-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 143151105 |
| Molecular Formula | C24H27F5N2O |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (2E,4E)-1-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]piperidin-1-yl]-2-prop-1-en-2-yl-4-(trifluoromethyl)hepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C(/C=C(\C(=C)C)C(=O)N1CCC([C@H](N)Cc2cc(F)ccc2F)CC1)C(F)(F)F |
| InChI | InChI=1S/C24H27F5N2O/c1-4-5-18(24(27,28)29)14-20(15(2)3)23(32)31-10-8-16(9-11-31)22(30)13-17-12-19(25)6-7-21(17)26/h4-7,12,14,16,22H,1-2,8-11,13,30H2,3H3/b18-5-,20-14+/t22-/m1/s1 |
| InChIKey | CVSGXZGLEGQLAG-VOJVKAEXSA-N |
| XLogP | 5.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|