C19H25F2NO2 — CID 122152363
1-[4-[(2,5-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-ethyl-2-methylbut-3-en-1-one (PubChem CID 122152363) has the molecular formula C19H25F2NO2 and a molecular weight of 337.41 g/mol. Its IUPAC name is 1-[4-[(2,5-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-ethyl-2-methylbut-3-en-1-one.
| Compound Name | 1-[4-[(2,5-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-ethyl-2-methylbut-3-en-1-one |
|---|---|
| PubChem CID | 122152363 |
| Molecular Formula | C19H25F2NO2 |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[4-[(2,5-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-2-ethyl-2-methylbut-3-en-1-one |
| SMILES | C=CC(C)(CC)C(=O)N1CCC(C(O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C19H25F2NO2/c1-4-19(3,5-2)18(24)22-10-8-13(9-11-22)17(23)15-12-14(20)6-7-16(15)21/h4,6-7,12-13,17,23H,1,5,8-11H2,2-3H3 |
| InChIKey | VGKQXXPPKUVORC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|