C20H20N4O3 — CID 53320018
3-[2-morpholin-4-yl-6-(pyridin-2-ylmethoxy)pyrimidin-4-yl]phenol (PubChem CID 53320018) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[2-morpholin-4-yl-6-(pyridin-2-ylmethoxy)pyrimidin-4-yl]phenol.
| Compound Name | 3-[2-morpholin-4-yl-6-(pyridin-2-ylmethoxy)pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 53320018 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-[2-morpholin-4-yl-6-(pyridin-2-ylmethoxy)pyrimidin-4-yl]phenol |
| SMILES | Oc1cccc(-c2cc(OCc3ccccn3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C20H20N4O3/c25-17-6-3-4-15(12-17)18-13-19(27-14-16-5-1-2-7-21-16)23-20(22-18)24-8-10-26-11-9-24/h1-7,12-13,25H,8-11,14H2 |
| InChIKey | JSOCNTWEGGQJPW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |