C26H33N5O4S — CID 53320981
5-(4-benzylsulfonylpiperazin-1-yl)-4-(3-ethoxypropylamino)-2-phenylpyridazin-3-one (PubChem CID 53320981) has the molecular formula C26H33N5O4S and a molecular weight of 511.65 g/mol. Its IUPAC name is 5-(4-benzylsulfonylpiperazin-1-yl)-4-(3-ethoxypropylamino)-2-phenylpyridazin-3-one.
| Compound Name | 5-(4-benzylsulfonylpiperazin-1-yl)-4-(3-ethoxypropylamino)-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 53320981 |
| Molecular Formula | C26H33N5O4S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 5-(4-benzylsulfonylpiperazin-1-yl)-4-(3-ethoxypropylamino)-2-phenylpyridazin-3-one |
| SMILES | CCOCCCNc1c(N2CCN(S(=O)(=O)Cc3ccccc3)CC2)cnn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C26H33N5O4S/c1-2-35-19-9-14-27-25-24(20-28-31(26(25)32)23-12-7-4-8-13-23)29-15-17-30(18-16-29)36(33,34)21-22-10-5-3-6-11-22/h3-8,10-13,20,27H,2,9,14-19,21H2,1H3 |
| InChIKey | NKAHVNIWQOFVPE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|