C28H36N4O4S2 — CID 53320982
5-(4-benzylsulfonylpiperazin-1-yl)-4-heptylsulfinyl-2-phenylpyridazin-3-one (PubChem CID 53320982) has the molecular formula C28H36N4O4S2 and a molecular weight of 556.75 g/mol. Its IUPAC name is 5-(4-benzylsulfonylpiperazin-1-yl)-4-heptylsulfinyl-2-phenylpyridazin-3-one.
| Compound Name | 5-(4-benzylsulfonylpiperazin-1-yl)-4-heptylsulfinyl-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 53320982 |
| Molecular Formula | C28H36N4O4S2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 5-(4-benzylsulfonylpiperazin-1-yl)-4-heptylsulfinyl-2-phenylpyridazin-3-one |
| SMILES | CCCCCCCS(=O)c1c(N2CCN(S(=O)(=O)Cc3ccccc3)CC2)cnn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C28H36N4O4S2/c1-2-3-4-5-12-21-37(34)27-26(22-29-32(28(27)33)25-15-10-7-11-16-25)30-17-19-31(20-18-30)38(35,36)23-24-13-8-6-9-14-24/h6-11,13-16,22H,2-5,12,17-21,23H2,1H3 |
| InChIKey | MXGOCUVMYFAMEX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|